:root {
  color-scheme: dark;
  --black: #050505;
  --ink: #090909;
  --white: #f7f7f5;
  --muted: #aaa9a5;
  --line: rgba(255, 255, 255, 0.17);
  --frame: clamp(0px, 1.05vw, 16px);
  --gutter: clamp(22px, 4vw, 64px);
  --ease: cubic-bezier(0.22, 1, 0.36, 1);
  --ferrari-red: #ff2800;
  --ferrari-red-on-light: #c92117;
}

* { box-sizing: border-box; }

html { scroll-behavior: smooth; background: var(--black); }

body {
  margin: 0;
  min-width: 320px;
  overflow-x: hidden;
  background: var(--black);
  color: var(--white);
  font-family: "Helvetica Neue", "Avenir Next", "Segoe UI", sans-serif;
  font-size: 16px;
  font-weight: 400;
  -webkit-font-smoothing: antialiased;
}

a { color: inherit; }
button, a { -webkit-tap-highlight-color: transparent; }
button { font: inherit; }

.skip-link {
  position: fixed;
  z-index: 100;
  left: 16px;
  top: 16px;
  transform: translateY(-160%);
  background: var(--white);
  color: #050505;
  padding: 12px 16px;
}
.skip-link:focus { transform: none; }

.site-header {
  position: fixed;
  z-index: 30;
  top: var(--frame);
  left: var(--frame);
  right: var(--frame);
  height: 72px;
  display: grid;
  grid-template-columns: 1fr auto 1fr;
  align-items: center;
  padding: 0 clamp(20px, 3vw, 48px);
  color: white;
  transition: transform 650ms var(--ease), background-color 450ms ease, backdrop-filter 450ms ease;
}

.site-header.is-hidden { transform: translateY(calc(-100% - var(--frame) - 8px)); }
.site-header.is-scrolled { background: rgba(4, 4, 4, 0.72); backdrop-filter: blur(18px); }

.menu-trigger,
.language-trigger,
.menu-close {
  border: 0;
  background: none;
  color: inherit;
  cursor: pointer;
}

.menu-trigger {
  justify-self: start;
  display: inline-flex;
  align-items: center;
  gap: 12px;
  min-height: 44px;
  padding: 0;
  font-size: 0.78rem;
  letter-spacing: 0.04em;
}
.menu-trigger span:first-child { position: relative; width: 22px; height: 13px; }
.menu-trigger span:first-child::before,
.menu-trigger span:first-child::after { content: ""; position: absolute; left: 0; height: 1px; background: currentColor; }
.menu-trigger span:first-child::before { top: 0; width: 22px; box-shadow: 0 12px currentColor; }
.menu-trigger span:first-child::after { top: 6px; width: 14px; }

.wordmark {
  width: 160px;
  display: block;
  text-decoration: none;
}
.wordmark img {
  display: block;
  width: 100%;
  height: auto;
}

.header-actions { justify-self: end; display: flex; align-items: center; gap: 18px; }
.language-trigger { min-height: 44px; font-size: 0.76rem; letter-spacing: 0.08em; }
.contact-button {
  min-height: 42px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  padding: 0 19px;
  background: var(--white);
  color: #080808;
  border: 1px solid var(--white);
  text-decoration: none;
  font-size: 0.76rem;
  font-weight: 450;
  transition: background-color 220ms ease, color 220ms ease;
}
.contact-button:hover { background: transparent; color: white; }

.menu-panel {
  position: fixed;
  z-index: 60;
  inset: 0;
  padding: 100px var(--gutter) 48px;
  display: flex;
  flex-direction: column;
  justify-content: center;
  gap: 18px;
  background: rgba(5, 5, 5, 0.98);
}
.menu-panel[hidden] { display: none; }
.menu-panel a { font-size: clamp(2rem, 5vw, 4.6rem); font-weight: 250; line-height: 1.05; text-decoration: none; }
.menu-panel a:hover { color: var(--muted); }
.menu-close { position: absolute; top: 28px; right: var(--gutter); font-size: 2.4rem; min-width: 44px; min-height: 44px; }

main { padding: var(--frame); }

.hero {
  position: relative;
  min-height: calc(100svh - (var(--frame) * 2));
  overflow: hidden;
  background: #111;
}

.hero-media,
.section-media {
  position: absolute;
  inset: 0;
  width: 100%;
  height: 100%;
  object-fit: cover;
}
.hero-media { object-position: 50% 48%; transform: scale(1.012); animation: settle 1.6s var(--ease) both; }
@keyframes settle { from { opacity: 0; transform: scale(1.05); } to { opacity: 1; transform: scale(1.012); } }

.hero-shade {
  position: absolute;
  inset: 0;
  background:
    linear-gradient(180deg, rgba(0,0,0,.48) 0%, transparent 28%, transparent 58%, rgba(0,0,0,.74) 100%),
    linear-gradient(90deg, rgba(0,0,0,.5) 0%, transparent 42%, rgba(0,0,0,.12) 100%);
}

.hero-title-wrap { position: absolute; z-index: 2; left: var(--gutter); bottom: clamp(106px, 14vh, 154px); }
.eyebrow { margin: 0 0 17px; color: rgba(255,255,255,.64); font-size: .7rem; letter-spacing: .18em; }
.hero h1 { margin: 0; font-size: clamp(2.8rem, 5.25vw, 5.4rem); font-weight: 200; letter-spacing: -.045em; line-height: .94; white-space: nowrap; }

.hero-promise {
  position: absolute;
  z-index: 2;
  right: var(--gutter);
  bottom: clamp(116px, 15vh, 165px);
  width: min(270px, 25vw);
  margin: 0;
  padding-top: 16px;
  border-top: 1px solid rgba(255,255,255,.54);
  font-size: clamp(.9rem, 1.05vw, 1.08rem);
  line-height: 1.45;
}

.discover {
  position: absolute;
  z-index: 3;
  left: 50%;
  bottom: 25px;
  transform: translateX(-50%);
  display: flex;
  flex-direction: column;
  align-items: center;
  gap: 6px;
  min-width: 72px;
  min-height: 48px;
  font-size: .68rem;
  letter-spacing: .06em;
  text-decoration: none;
}
.discover svg { width: 18px; fill: none; stroke: currentColor; stroke-width: 1.25; animation: drift 1.8s ease-in-out infinite; }
@keyframes drift { 50% { transform: translateY(5px); } }

.definition {
  min-height: min(780px, 88svh);
  display: grid;
  grid-template-columns: 1fr 1fr;
  align-items: center;
  gap: 7vw;
  padding: 70px var(--gutter) 90px;
  background: var(--black);
}
.breadcrumb { align-self: start; display: flex; gap: 12px; padding-top: 3px; color: #8c8c89; font-size: .78rem; }
.breadcrumb a { text-underline-offset: 4px; }
.definition-copy { max-width: 590px; padding-right: 3vw; }
.definition-copy h2,
.values h2,
.experience h2,
.excellence h2,
.why h2,
.philosophy h2,
.faqs h2,
.valuation h2 { margin: 0; font-size: clamp(1.85rem, 2.35vw, 2.65rem); font-weight: 200; letter-spacing: -.045em; line-height: 1.05; }
.definition-copy h2,
.values h2,
.experience h2,
.excellence h2,
.why h2,
.philosophy h2,
.faqs h2,
.valuation h2 { font-weight: 300; }
.definition-copy h2 { line-height: 1.04; }
.definition-copy h2 span { white-space: nowrap; }
.definition-copy > p { max-width: 560px; margin: 25px 0 0; color: #bdbdb9; line-height: 1.68; }
.definition-copy p:last-child { color: var(--white); }

.values {
  position: relative;
  min-height: 880px;
  overflow: hidden;
}
.section-media { object-position: 62% 50%; }
.values .section-media { object-position: 50% 50%; }
.section-veil { position: absolute; inset: 0; background: linear-gradient(180deg, rgba(0,0,0,.28), rgba(0,0,0,.12) 34%, rgba(0,0,0,.86) 100%), linear-gradient(90deg, rgba(0,0,0,.34), transparent 70%); }
.values .section-veil { background: radial-gradient(ellipse 66% 76% at 53% 49%, rgba(0,0,0,.08) 0%, rgba(0,0,0,.17) 38%, rgba(0,0,0,.66) 78%, rgba(0,0,0,.94) 100%), linear-gradient(180deg, rgba(0,0,0,.5), rgba(0,0,0,.03) 32%, rgba(0,0,0,.72) 100%); }
.values-inner { position: absolute; z-index: 2; inset: 0; width: min(1420px, calc(100% - var(--gutter) - var(--gutter))); display: flex; flex-direction: column; margin: auto; padding: clamp(100px, 10vh, 145px) 0 clamp(22px, 2.6vw, 40px); }
.values h2 { margin: 0; font-weight: 300; letter-spacing: -.04em; }
.values h2 span { color: #555557; }
.value-grid { width: 100%; display: grid; grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 26px 30px; margin-top: auto; }
.value-grid article { position: relative; min-height: 164px; padding: 25px 27px; border: 1px solid rgba(205,210,216,.25); background: linear-gradient(135deg, rgba(29,30,33,.26), rgba(8,9,11,.13)); box-shadow: inset 0 0 0 .5px rgba(255,255,255,.025); backdrop-filter: blur(13px); -webkit-backdrop-filter: blur(13px); }
.value-grid h3 { margin: 35px 0 9px; font-size: 1.08rem; font-weight: 400; }
.value-grid p { max-width: 230px; margin: 0; color: #bcbcb8; font-size: .88rem; line-height: 1.55; }
.value-mark { position: absolute; right: 24px; top: 20px; width: 22px; height: 22px; fill: none; stroke: rgba(205,210,216,.72); stroke-width: 1.15; stroke-linejoin: round; }

.experience {
  position: relative;
  min-height: 1040px;
  padding: clamp(86px, 8vw, 128px) var(--gutter) 92px;
  background: var(--black);
  overflow: hidden;
}

.experience-heading { width: min(1420px, 100%); margin: 0 auto; }
.experience-heading h2 span,
.excellence h2 span { color: #777775; }

.experience-stage { position: relative; width: min(1050px, 84vw); height: 680px; margin: 14px auto 0; }
.experience-ring { position: absolute; z-index: 1; left: 50%; top: 50%; width: min(690px, 70vw); aspect-ratio: 1; overflow: visible; transform: translate(-50%, -50%); }
.experience-ring circle { fill: none; vector-effect: non-scaling-stroke; }
.ring-base { stroke: rgba(92,94,98,.3); stroke-width: 1; }
.ring-progress { stroke: rgba(214,218,222,.82); stroke-width: 1.25; stroke-linecap: round; stroke-dasharray: 1; stroke-dashoffset: 0; transform: rotate(180deg); transform-origin: 50% 50%; }
.experience-visual { position: absolute; z-index: 0; inset: 0 auto 0 50%; width: 43%; margin: 0; transform: translateX(-50%); overflow: hidden; }
.experience-visual::before { content: ""; position: absolute; z-index: 1; inset: 0; box-shadow: inset 0 0 100px rgba(0,0,0,.58); }
.experience-visual img { width: 100%; height: 100%; object-fit: cover; object-position: 48% 50%; }

.experience-note {
  position: absolute;
  z-index: 2;
  width: min(240px, 23vw);
  padding: 17px 19px 18px;
  border: 1px solid rgba(205,210,216,.27);
  border-radius: 18px;
  background: rgba(12,12,13,.72);
  box-shadow: 0 16px 42px rgba(0,0,0,.28);
  backdrop-filter: blur(14px);
  -webkit-backdrop-filter: blur(14px);
}
.experience-note span { color: #767674; font-size: .68rem; letter-spacing: .14em; }
.experience-note h3 { margin: 12px 0 7px; font-size: 1.05rem; font-weight: 500; }
.experience-note p { margin: 0; color: #a9a9a5; font-size: .84rem; line-height: 1.5; }
.note-outline { display: none; }
.note-trust { left: 0; top: 250px; }
.note-calm { left: 50%; top: -32px; transform: translateX(-50%); }
.note-freedom { right: 0; top: 250px; }
.experience-statement { position: absolute; z-index: 3; left: max(var(--gutter), calc((100% - 1420px) / 2)); bottom: 64px; width: min(440px, 38vw); margin: 0; padding: 4px 0 4px 25px; border-left: 1px solid rgba(205,210,216,.54); color: #92928f; line-height: 1.65; }

.excellence {
  position: relative;
  min-height: 920px;
  display: flex;
  align-items: center;
  justify-content: flex-end;
  overflow: hidden;
}
.excellence .section-media { object-position: 50% 52%; }
.excellence-veil { position: absolute; inset: 0; background: linear-gradient(90deg, rgba(0,0,0,.12) 0%, rgba(0,0,0,.22) 43%, rgba(0,0,0,.9) 79%, rgba(0,0,0,.96) 100%), linear-gradient(180deg, rgba(0,0,0,.32), transparent 24%, transparent 72%, rgba(0,0,0,.72)); }
.app-notifications { position: absolute; z-index: 2; left: clamp(30px, 5vw, 84px); top: 50%; width: min(470px, 38vw); display: flex; flex-direction: column; gap: 72px; transform: translateY(-50%); isolation: isolate; }
.app-notifications::before { content: ""; position: absolute; z-index: 0; top: 45px; bottom: 45px; left: 50%; width: 1px; background: repeating-linear-gradient(to bottom, rgba(255,255,255,.48) 0 7px, transparent 7px 15px); }
.app-notification { position: relative; z-index: 1; box-sizing: border-box; width: calc(100% - 34px); display: grid; grid-template-columns: 54px minmax(0, 1fr); align-items: center; gap: 16px; padding: 18px 22px 19px; border: 1px solid rgba(255,255,255,.27); border-radius: 28px; background: linear-gradient(135deg, rgba(10,10,12,.76), rgba(22,22,25,.56)); box-shadow: 0 20px 48px rgba(0,0,0,.3); backdrop-filter: blur(22px); -webkit-backdrop-filter: blur(22px); }
.notification-logo { display: block; width: 54px; height: 54px; border: 1px solid rgba(255,255,255,.1); border-radius: 13px; object-fit: cover; }
.notification-content { min-width: 0; }
.notification-meta { display: flex; align-items: center; justify-content: space-between; gap: 16px; color: #777774; font-size: .72rem; }
.app-notification strong { color: #f2f2ef; font-size: .9rem; font-weight: 600; }
.app-notification time { flex-shrink: 0; white-space: nowrap; font-variant-numeric: tabular-nums; font-size: .75rem; color: #a6a6a0; }
.app-notification p { margin: 5px 0 0; color: #e0e0dc; font-size: .9rem; line-height: 1.42; }
.notification-two { align-self: flex-end; }
.notification-three { margin-left: 13px; }
.excellence-copy { position: relative; z-index: 2; width: min(590px, 46vw); margin-right: var(--gutter); padding: 60px 0; }
.excellence-lead { max-width: 500px; margin: 28px 0 45px; color: #b7b7b3; line-height: 1.65; }
.promise-list { margin: 0; padding: 0; list-style: none; }
.promise-list li { position: relative; padding: 23px 0; line-height: 1.5; }
.promise-list li::before { content: ""; position: absolute; top: 0; left: 0; width: 100%; height: 1px; background: linear-gradient(90deg, rgba(255,255,255,.36), rgba(255,255,255,.04)); }
.promise-list li:last-child::after { content: ""; position: absolute; bottom: 0; left: 0; width: 100%; height: 1px; background: linear-gradient(90deg, rgba(255,255,255,.36), rgba(255,255,255,.04)); }

.why { min-height: 760px; display: grid; place-items: center; padding: 130px var(--gutter); background: var(--black); }
.why-inner { width: min(760px, 66vw); }
.why-inner h2 { margin-bottom: 36px; }
.founder-quote { margin: 0; padding: 0; border: 0; }
.founder-quote p { margin: 0 0 27px; color: #c9c9c5; font-size: clamp(1.02rem, 1.35vw, 1.28rem); line-height: 1.72; }
.founder-quote p:first-child { color: #f0f0ed; }
.founder-quote .founder-declaration { margin-top: 38px; }
.founder-declaration strong,
.founder-declaration span { display: block; max-width: 700px; color: var(--white); font-size: clamp(1.25rem, 1.75vw, 1.65rem); font-weight: 450; letter-spacing: -.025em; line-height: 1.42; }
.founder-declaration span { margin-top: 8px; }
.signature { display: flex; align-items: center; gap: 18px; margin: 45px 0 0; }
.signature img { display: block; width: 72px; height: 72px; border: 1px solid rgba(255,255,255,.1); border-radius: 14px; object-fit: cover; }
.signature p { margin: 0; line-height: 1.35; }
.signature strong,
.signature span { display: block; }
.signature strong { color: var(--white); font-size: 1rem; font-weight: 550; }
.signature span { margin-top: 5px; color: #777775; font-size: .78rem; letter-spacing: .06em; }

.philosophy { min-height: 620px; display: grid; grid-template-columns: 1fr 1.05fr; background: var(--black); }
.philosophy-copy { display: flex; flex-direction: column; justify-content: center; padding: 76px clamp(32px, 6vw, 100px); }
.philosophy-principle { margin: 38px 0 17px; color: var(--white); font-size: 1rem; }
.philosophy-copy > p:not(.philosophy-principle) { max-width: 510px; margin: 0; color: #aaa9a5; line-height: 1.7; }
.text-link { align-self: flex-start; margin-top: 34px; padding-bottom: 8px; border-bottom: 1px solid rgba(255,255,255,.38); font-size: .8rem; text-decoration: none; }
.text-link span { margin-left: 18px; }
.philosophy-visual { position: relative; min-height: 600px; margin: 0; overflow: hidden; }
.philosophy-visual::after { content: ""; position: absolute; inset: 0; background: linear-gradient(90deg, rgba(0,0,0,.55), transparent 28%), linear-gradient(180deg, transparent 68%, rgba(0,0,0,.62)); }
.philosophy-visual img { width: 100%; height: 100%; object-fit: cover; object-position: 52% 51%; }

.faqs { padding: clamp(120px, 12vw, 190px) var(--gutter); background: var(--black); }
.faq-heading { text-align: center; }
.faq-heading h2 { white-space: nowrap; }
.faq-heading > p:last-child { margin: 22px 0 0; color: #777775; }
.accordion { width: min(760px, 100%); margin: 64px auto 0; }
.accordion details { margin: 0 0 14px; overflow: hidden; border: 1px solid rgba(255,255,255,.09); border-radius: 8px; background: #171717; transition: background-color 220ms ease, border-color 220ms ease; }
.accordion details[open] { background: #181818; border-color: rgba(255,255,255,.18); }
.accordion summary { min-height: 70px; display: flex; align-items: center; justify-content: space-between; gap: 28px; padding: 16px 22px; cursor: pointer; list-style: none; font-size: .96rem; }
.accordion summary::-webkit-details-marker { display: none; }
.accordion summary svg { flex: 0 0 18px; width: 18px; fill: none; stroke: currentColor; stroke-width: 1.25; transition: transform 1000ms cubic-bezier(.4,0,.2,1); }
.accordion details[open] summary svg { transform: rotate(180deg); }
.accordion details[data-expanded="false"] summary svg { transform: rotate(0); }
.accordion details[data-expanded="true"] summary svg { transform: rotate(180deg); }
.accordion details { overflow-anchor: none; }
.answer { margin: 0 22px; padding: 20px 42px 24px 0; border-top: 1px solid rgba(255,255,255,.12); color: #aaa9a6; line-height: 1.68; }
.answer p { margin: 0; }

.valuation { position: relative; min-height: 760px; display: flex; align-items: center; overflow: hidden; }
.valuation .section-media { object-position: 50% 72%; transform: scale(1.02); }
.valuation-veil { position: absolute; inset: 0; background: linear-gradient(90deg, rgba(0,0,0,.94) 0%, rgba(0,0,0,.76) 38%, rgba(0,0,0,.16) 76%), linear-gradient(180deg, rgba(0,0,0,.18), rgba(0,0,0,.6)); }
.valuation-copy { position: relative; z-index: 2; width: min(590px, 46vw); margin-left: var(--gutter); }
.valuation-copy > p { max-width: 440px; margin: 27px 0 34px; color: #b7b7b3; line-height: 1.65; }
.primary-button { min-height: 48px; display: inline-flex; align-items: center; gap: 25px; padding: 0 23px; background: var(--white); color: #080808; border: 1px solid var(--white); text-decoration: none; font-size: .78rem; font-weight: 450; transition: background-color 220ms ease, color 220ms ease; }
.primary-button:hover { background: transparent; color: var(--white); }

.footer-connect { padding: 94px var(--gutter); border-top: 1px solid rgba(255,255,255,.11); border-bottom: 1px solid rgba(255,255,255,.11); background: var(--black); }
.footer-connect-inner { width: min(1320px, 100%); display: grid; grid-template-columns: 1fr 1fr; gap: clamp(70px, 12vw, 190px); margin: 0 auto; }
.footer-connect h2 { margin: 0; font-size: 1.45rem; font-weight: 550; }
.footer-connect p { max-width: 520px; margin: 19px 0 25px; color: #a0a09c; line-height: 1.65; }
.footer-contact-lines { display: flex; flex-direction: column; align-items: flex-start; gap: 14px; margin: 31px 0 29px; }
.footer-contact-lines a { color: #c5c5c1; font-size: clamp(1.25rem, 1.7vw, 1.8rem); font-weight: 300; line-height: 1.25; text-decoration: none; }
.footer-outline-button { min-width: 220px; min-height: 56px; display: inline-flex; align-items: center; justify-content: space-between; gap: 28px; padding: 0 22px; border: 1px solid rgba(255,255,255,.84); border-radius: 4px; text-decoration: none; font-size: .9rem; font-weight: 500; transition: color 200ms ease, background-color 200ms ease; }
.footer-outline-button span { font-size: 1.25rem; line-height: 1; }
.footer-outline-button:hover { background: var(--white); color: var(--black); }

.site-footer { padding: 92px max(var(--gutter), calc((100vw - 1320px) / 2)) 32px; background: var(--black); }
.footer-main { display: grid; grid-template-columns: 1.65fr repeat(3, .72fr); gap: clamp(36px, 5vw, 78px); }
.footer-brand { min-width: 0; }
.footer-logo { width: min(360px, 100%); display: block; }
.footer-logo img { display: block; width: 100%; height: auto; }
.footer-brand > p { max-width: 330px; margin: 18px 0 28px; color: #858581; font-size: .82rem; line-height: 1.6; }
.language-picker { position: relative; width: 170px; }
.language-picker summary { min-height: 42px; display: grid; grid-template-columns: 17px 1fr auto; align-items: center; gap: 10px; padding: 0 13px; border: 1px solid rgba(255,255,255,.24); cursor: pointer; list-style: none; font-size: .72rem; letter-spacing: .05em; }
.language-picker summary svg { width: 16px; fill: none; stroke: currentColor; stroke-width: 1.25; }
.language-picker summary::-webkit-details-marker { display: none; }
.language-picker div { position: absolute; z-index: 5; bottom: calc(100% + 6px); left: 0; right: 0; display: flex; flex-direction: column; padding: 7px; border: 1px solid rgba(255,255,255,.17); background: #111; }
.language-picker a,
.language-picker div span { padding: 9px 8px; color: #b2b2ae; font-size: .76rem; text-decoration: none; }
.footer-column { display: flex; flex-direction: column; align-items: flex-start; }
.footer-column h2 { margin: 4px 0 24px; color: #777773; font-size: .69rem; font-weight: 450; letter-spacing: .13em; text-transform: uppercase; }
.footer-column a,
.footer-column span { margin-bottom: 14px; color: #b0b0ac; font-size: .8rem; line-height: 1.45; text-decoration: none; }
.footer-column a:hover { color: var(--white); }
.footer-legal { display: flex; gap: 25px; padding-top: 30px; margin-top: 68px; border-top: 1px solid rgba(255,255,255,.1); color: #626260; font-size: .68rem; }

@media (prefers-reduced-motion: no-preference) {
  .js [data-reveal] { opacity: 0; transform: translateY(28px); transition: opacity 900ms var(--ease), transform 900ms var(--ease); }
  .js [data-reveal].is-visible { opacity: 1; transform: none; }
  .js .experience-stage .ring-progress { stroke-dashoffset: 1; transition: stroke-dashoffset 4400ms cubic-bezier(.4, 0, .2, 1) 240ms; }
  .js .experience-stage.is-visible .ring-progress { stroke-dashoffset: 0; }
}

@media (max-width: 900px) {
  .site-header { height: 66px; }
  .language-trigger { display: none; }
  .definition { grid-template-columns: 1fr; min-height: auto; padding-top: 54px; padding-bottom: 110px; }
  .definition-copy { justify-self: end; width: min(680px, 86%); padding: 70px 0 0; }
  .values { min-height: 820px; }
  .values-inner { padding-top: 96px; padding-bottom: 28px; }
  .value-grid { grid-template-columns: repeat(2, 1fr); gap: 18px; }
  .value-grid article { min-height: 150px; }
  .experience { min-height: 980px; }
  .experience-stage { width: 100%; height: 710px; }
  .experience-visual { width: 49%; }
  .experience-note { width: 29%; }
  .note-trust, .note-freedom { top: 265px; }
  .experience-statement { bottom: 52px; }
  .app-notifications { width: 35vw; }
  .excellence-copy { width: 54vw; }
  .why-inner { width: min(690px, 82vw); }
  .philosophy { grid-template-columns: 1fr; }
  .philosophy-visual { min-height: 480px; order: -1; }
  .philosophy-copy { min-height: 480px; }
  .footer-main { grid-template-columns: 1.35fr repeat(3, .72fr); gap: 32px; }
}

@media (max-width: 600px) {
  :root { --gutter: 20px; --frame: 0px; }
  .site-header { top: 0; left: 0; right: 0; padding: 0 20px; }
  .menu-trigger span:last-child { display: none; }
  .header-actions { gap: 0; }
  .contact-button { display: none; }
  .wordmark { width: 132px; }
  .hero { min-height: 100svh; }
  .hero-media { object-position: 67% 50%; }
  .hero-title-wrap { left: 20px; bottom: 116px; }
  .eyebrow { font-size: .6rem; }
  .hero h1 { font-size: clamp(1.78rem, 7.7vw, 2.2rem); white-space: nowrap; }
  .hero-promise { right: 20px; bottom: 43px; width: 48%; font-size: .76rem; }
  .discover { left: 20px; bottom: 32px; transform: none; align-items: flex-start; }
  .definition { padding: 32px 20px 92px; gap: 0; }
  .breadcrumb { font-size: .72rem; }
  .definition-copy { width: 100%; padding-top: 92px; }
  .definition-copy h2,
  .values h2,
  .experience h2,
  .excellence h2,
  .why h2,
  .philosophy h2,
  .faqs h2,
  .valuation h2 { font-size: 2rem; }
  .definition-copy > p { font-size: .96rem; }
  .values { min-height: 900px; }
  .section-media { object-position: 70% 50%; }
  .values .section-media { object-position: 34% 50%; }
  .values-inner { width: calc(100% - 40px); padding: 78px 0 20px; }
  .value-grid { grid-template-columns: 1fr; gap: 12px; }
  .value-grid article { min-height: 122px; padding: 18px 18px 20px; }
  .value-grid h3 { margin: 21px 0 6px; }
  .value-grid p { font-size: .82rem; }
  .experience { min-height: auto; padding: 88px 20px 84px; }
  .experience-stage { height: auto; margin-top: 50px; display: grid; grid-template-columns: 1fr; gap: 10px; }
  .experience-ring { top: 270px; width: min(520px, 126vw); }
  .experience-visual { position: relative; inset: auto; width: 100%; height: 540px; transform: none; }
  .experience-note { position: relative; inset: auto; width: 100%; min-height: 122px; transform: none; }
  .experience-note { display: grid; grid-template-columns: 34px 95px 1fr; align-items: start; column-gap: 10px; }
  .experience-note span { margin-top: 4px; }
  .experience-note h3 { margin: 0; }
  .experience-note p { margin: 0; }
  .experience-statement { position: relative; left: auto; bottom: auto; width: 100%; margin-top: 48px; padding-left: 20px; }
  .excellence { min-height: 1060px; align-items: flex-end; }
  .excellence .section-media { object-position: 49% 40%; }
  .excellence-veil { background: linear-gradient(180deg, rgba(0,0,0,.14) 0%, rgba(0,0,0,.18) 38%, rgba(0,0,0,.95) 73%, #050505 100%); }
  .app-notifications { left: 20px; right: 20px; top: 82px; width: auto; gap: 54px; transform: none; }
  .app-notifications::before { top: 36px; bottom: 36px; }
  .app-notification { width: calc(100% - 18px); grid-template-columns: 44px minmax(0, 1fr); gap: 12px; padding: 14px 16px 15px; border-radius: 23px; }
  .notification-logo { width: 44px; height: 44px; border-radius: 11px; }
  .notification-meta { font-size: .65rem; }
  .app-notification strong { font-size: .78rem; }
  .app-notification p { font-size: .78rem; }
  .notification-two { margin-left: 0; }
  .notification-three { margin-left: 8px; }
  .excellence-copy { width: 100%; margin: 0; padding: 70px 20px 44px; }
  .excellence-lead { font-size: .95rem; }
  .why { min-height: auto; padding: 110px 20px; }
  .why-inner { width: 100%; }
  .why-inner h2 { margin-bottom: 30px; }
  .founder-quote p { font-size: .98rem; line-height: 1.68; }
  .founder-quote .founder-declaration { margin-top: 32px; }
  .founder-declaration strong,
  .founder-declaration span { font-size: 1.18rem; line-height: 1.46; }
  .signature { margin-top: 38px; }
  .signature img { width: 62px; height: 62px; border-radius: 12px; }
  .philosophy-visual { min-height: 400px; }
  .philosophy-copy { min-height: auto; padding: 80px 20px 88px; }
  .faqs { padding: 108px 20px; }
  .faq-heading { text-align: left; }
  .faq-heading h2 { white-space: normal; }
  .accordion { margin-top: 48px; }
  .accordion details { margin-bottom: 11px; }
  .accordion summary { min-height: 72px; padding: 15px 17px; font-size: .9rem; }
  .answer { padding: 0 48px 21px 17px; font-size: .9rem; }
  .valuation { min-height: 720px; align-items: flex-end; }
  .valuation .section-media { object-position: 38% 50%; }
  .valuation-veil { background: linear-gradient(180deg, rgba(0,0,0,.18), rgba(0,0,0,.2) 42%, rgba(0,0,0,.94) 82%, #050505); }
  .valuation-copy { width: 100%; margin: 0; padding: 0 20px 64px; }
  .footer-connect { padding: 78px 20px; }
  .footer-connect-inner { grid-template-columns: 1fr; gap: 70px; }
  .footer-contact-lines a { font-size: 1.32rem; }
  .footer-outline-button { width: 100%; min-width: 0; }
  .site-footer { padding: 78px 20px 28px; }
  .footer-main { grid-template-columns: 1fr 1fr; gap: 58px 28px; }
  .footer-brand { grid-column: 1 / -1; }
  .footer-logo { width: 300px; }
  .footer-column:last-child { grid-column: 1 / -1; }
  .footer-legal { flex-wrap: wrap; row-gap: 12px; margin-top: 54px; }
}

@media (prefers-reduced-motion: reduce) {
  html { scroll-behavior: auto; }
  *, *::before, *::after { animation-duration: .01ms !important; animation-iteration-count: 1 !important; transition-duration: .01ms !important; }
}

/* CRO refinement: preserve the visual language; clarify the decision and the next step. */
:root { --readable: #c9c9c5; }
body.menu-open, body.dialog-open { overflow: hidden; }
:focus-visible { outline: 2px solid var(--white); outline-offset: 5px; }
section[id], main[id] { scroll-margin-top: 96px; }
img { max-width: 100%; }
button { cursor: pointer; }
a, button, summary, input, select, textarea { touch-action: manipulation; }
button, input, select, textarea { font: inherit; }
.menu-trigger, .contact-button, .primary-button, .text-link, .footer-column a, .footer-column span { font-size: .875rem; }
.contact-button, .text-link { min-height: 44px; }
.text-link { display: inline-flex; align-items: center; }
.eyebrow { font-size: .75rem; color: #bfbfbb; }
.discover { font-size: .875rem; min-width: max-content; }
.discover svg { animation: none; transition: transform 1100ms cubic-bezier(.4,0,.2,1); }
.discover:focus-visible svg { transform: translateY(8px); }
@media (hover: hover) and (pointer: fine) {
 .discover:hover svg { transform: translateY(8px); }
}
@media (prefers-reduced-motion: reduce) {
 .discover svg { transform: none !important; transition: none !important; }
}
.hero-media { animation: none; opacity: 1; }
.hero-title-wrap { max-width: calc(100% - var(--gutter) * 2); }
.hero h1 { font-size: clamp(2.6rem, 5.05vw, 5.4rem); white-space: normal; line-height: 1.08; }
.hero-promise { font-size: 1rem; }
.header-language { position: relative; font-size: .875rem; }
.header-language summary { display: flex; align-items: center; gap: 8px; min-height: 44px; cursor: pointer; list-style: none; }
.header-language summary::-webkit-details-marker { display: none; }
.language-options { position: absolute; z-index: 2; top: calc(100% + 10px); right: 0; min-width: 150px; padding: 8px; border: 1px solid var(--line); background: #101010; }
.language-options a { display: block; padding: 12px; text-decoration: none; }
.language-options a:hover, .language-options a[aria-current] { background: #252525; }
.menu-languages { display: flex; gap: 24px; margin-top: 22px; }
.menu-languages a { font-size: 1rem; line-height: 1.6; }
.definition { grid-template-rows: auto 1fr; gap: 40px 7vw; min-height: 720px; padding-top: 60px; padding-bottom: 100px; }
.breadcrumb { grid-column: 1 / -1; font-size: .875rem; }
.definition-context { align-self: center; }
.definition-intro { margin: 18px 0 38px; color: var(--white); font-size: clamp(1.65rem, 2.5vw, 2.6rem); font-weight: 300; line-height: 1.15; letter-spacing: -.035em; }
.definition-outcomes { margin: 0; padding: 0; list-style: none; color: var(--readable); }
.definition-outcomes li { padding: 13px 0; max-width: 340px; border-top: 1px solid var(--line); line-height: 1.55; }
.definition-copy { padding-right: 0; }
.definition-copy h2 span { white-space: normal; }
.definition-copy > p { font-size: 1rem; color: var(--readable); }
.definition-copy .definition-limit { padding-top: 20px; border-top: 1px solid var(--line); }
.values { min-height: 830px; }
.values-inner { position: relative; min-height: inherit; padding-top: 70px; }
.value-grid { padding-top: 100px; }
.value-grid p { max-width: 34ch; font-size: 1rem; color: #deded8; }
.value-grid article { background: rgba(12,12,14,.64); padding: 25px 27px; }
.value-grid h3 { margin-top: 30px; }
.philosophy-copy { padding-top: 72px; padding-bottom: 72px; }
.philosophy-copy > .eyebrow { margin: 0 0 28px !important; font-size: .75rem; }
.philosophy-copy > p:not(.philosophy-principle) { color: var(--readable); }
.philosophy-visual { min-height: 640px; }
.treatment-distinction { margin: 28px 0 0; }
.treatment-distinction div { padding: 20px 0; border-top: 1px solid var(--line); }
.treatment-distinction dt { margin: 0 0 7px; font-size: 1rem; }
.treatment-distinction dd { margin: 0; color: var(--readable); font-size: 1rem; line-height: 1.65; }
.scope { padding: clamp(82px, 8vw, 124px) var(--gutter); }
.scope-heading { display: grid; grid-template-columns: 1fr 1fr; gap: 20px 7vw; max-width: 1320px; margin: auto; align-items: end; }
.scope-heading > .eyebrow { grid-column: 1 / -1; margin-bottom: 8px; }
.scope h2 { margin: 0; font-size: clamp(2rem, 3.2vw, 3.4rem); font-weight: 300; letter-spacing: -.04em; line-height: 1.08; }
.scope-heading > p:last-child { color: var(--readable); margin: 0; max-width: 530px; line-height: 1.7; }
.scope-grid { display: grid; grid-template-columns: repeat(3, minmax(0,1fr)); gap: 42px; max-width: 1320px; margin: 70px auto 0; }
.scope-grid article { border-top: 1px solid var(--line); padding-top: 24px; }
.step-number { font-size: .75rem; letter-spacing: .12em; color: #b8b8b4; }
.scope-grid h3 { margin: 25px 0 12px; font-size: 1.125rem; font-weight: 400; }
.scope-grid p { margin: 0; color: var(--readable); line-height: 1.65; }
.scope-close { max-width: 1320px; margin: 54px auto 0; padding-top: 26px; border-top: 1px solid var(--line); display: flex; justify-content: space-between; gap: 40px; align-items: center; }
.scope-close p { margin: 0; max-width: 620px; color: var(--readable); line-height: 1.65; }
.scope-close .text-link { margin: 0; flex-shrink: 0; }
.experience-note { width: min(270px, 25vw); }
.experience-note p { font-size: 1rem; color: #d1d1ca; }
.experience-note span { font-size: .75rem; color: #b5b5b0; }
.experience-statement { color: #bcbcb5; font-size: 1rem; }
.experience-stage .ring-progress { stroke-dashoffset: 0; }
.experience-stage.motion-ready .ring-progress { stroke-dashoffset: 1; transition: stroke-dashoffset 4400ms cubic-bezier(.4,0,.2,1) 240ms; }
.experience-stage.ring-complete .ring-progress { stroke-dashoffset: 0; }
.excellence-lead, .promise-list li { font-size: 1rem; color: #d1d1cb; }
.app-notification strong, .app-notification p { font-size: 1rem; }
.notification-meta { align-items: flex-start; gap: 10px; }
.care-number { color: #b8b8b4; font-size: .75rem; }
.why { min-height: 660px; padding-top: 100px; padding-bottom: 100px; }
.signature span { color: #b3b3ad; font-size: .875rem; letter-spacing: .025em; }
.faqs { padding-top: 100px; padding-bottom: 110px; }
.faq-heading h2 { white-space: normal; }
.faq-heading > p:last-child { color: #bfbfb8; line-height: 1.6; }
.accordion { width: min(860px, 100%); margin-top: 48px; }
.accordion summary, .answer { font-size: 1rem; }
.answer { color: #c9c9c3; }
.valuation-copy { width: min(620px, 50vw); padding: 60px 0; }
.valuation-copy > p { font-size: 1rem; color: #d0d0c9; }
.valuation-copy .contact-expectation { font-size: .875rem; line-height: 1.6; margin: 22px 0 12px; max-width: 350px; }
.contact-phone { display: inline-flex; align-items: center; min-height: 44px; font-size: 1rem; text-underline-offset: 5px; }
.footer-connect { padding-top: 76px; padding-bottom: 76px; }
.footer-connect h2 { font-weight: 300; font-size: clamp(1.7rem, 2.2vw, 2.3rem); line-height: 1.15; letter-spacing: -.035em; }
.footer-connect .eyebrow { margin-top: 0; font-size: .75rem; }
.footer-connect p { color: var(--readable); }
.first-conversation .direct-contact-note { font-size: .875rem; padding-top: 20px; border-top: 1px solid var(--line); }
.footer-brand > p { font-size: .875rem; color: #b8b8b1; }
.footer-column h2 { font-size: .75rem; color: #b3b3ad; }
.footer-column a { min-height: 32px; margin-bottom: 8px; display: inline-flex; align-items: center; }
.language-picker { width: 185px; }
.language-picker summary, .language-picker a, .language-picker div span { font-size: .875rem; }
.footer-legal { font-size: .75rem; color: #a9a9a2; }
.enquiry-dialog { box-sizing: border-box; width: min(640px, calc(100% - 32px)); max-height: calc(100dvh - 32px); margin: auto; padding: clamp(28px,5vw,46px); color: var(--white); background: #111; border: 1px solid #565652; overscroll-behavior: contain; }
.enquiry-dialog::backdrop { background: rgba(0,0,0,.78); backdrop-filter: blur(8px); }
.dialog-close { position: absolute; top: 8px; right: 10px; width: 44px; height: 44px; border: 0; background: transparent; color: white; font-size: 2rem; }
.enquiry-dialog h2 { margin: 14px 0 20px; font-size: clamp(2rem,5vw,2.8rem); font-weight: 300; letter-spacing: -.04em; line-height: 1.05; }
.enquiry-intro { color: var(--readable); line-height: 1.6; margin-bottom: 28px; }
.enquiry-dialog label { display: flex; flex-wrap: wrap; justify-content: space-between; gap: 8px; font-size: 1rem; margin: 22px 0 10px; }
.field-meta { font-size: .875rem; color: #b8b8b1; }
.enquiry-dialog input, .enquiry-dialog select, .enquiry-dialog textarea { display: block; width: 100%; min-height: 50px; border: 1px solid #64645f; border-radius: 0; padding: 12px; background: #181818; color: var(--white); font-size: 1rem; }
.enquiry-dialog textarea { resize: vertical; min-height: 96px; }
.enquiry-dialog input::placeholder, .enquiry-dialog textarea::placeholder { color: #a9a9a4; opacity: 1; }
.message-preview { margin: 22px 0; }
.message-preview summary { font-size: .875rem; min-height: 44px; padding: 12px 0; cursor: pointer; }
.message-preview p { white-space: pre-wrap; overflow-wrap: anywhere; padding: 18px; border: 1px solid var(--line); color: var(--readable); font-size: .875rem; line-height: 1.6; }
.enquiry-actions { display: grid; gap: 12px; }
.enquiry-actions a { width: 100%; min-height: 52px; justify-content: space-between; font-size: 1rem; text-decoration: none; }
.secondary-button { display: inline-flex; align-items: center; padding: 12px 23px; color: var(--white); background: transparent; border: 1px solid #aaa9a5; }
.secondary-button:hover { background: #262626; }
.enquiry-privacy, .enquiry-status { font-size: .875rem; color: var(--readable); line-height: 1.6; }
.enquiry-status:empty { display: none; }
.enquiry-alternatives { display: flex; flex-wrap: wrap; gap: 12px 22px; border-top: 1px solid var(--line); padding-top: 22px; font-size: .875rem; }
.enquiry-alternatives > span { flex-basis: 100%; color: var(--readable); }
.enquiry-alternatives a { min-height: 30px; text-underline-offset: 4px; overflow-wrap: anywhere; }
@media (max-width: 1100px) {
 .hero-title-wrap { bottom: 190px; }
 .hero-promise { left: var(--gutter); right: auto; bottom: 95px; width: 280px; }
 .definition { gap: 32px 5vw; }
 .definition-copy h2 { font-size: 2rem; }
 .scope-close { flex-direction: column; align-items: flex-start; gap: 20px; }
 .scope-close .text-link { flex-shrink: 1; }
}

/* Language choices sit directly on the page; their chevrons share the text centre. */
.header-language summary, .language-picker summary { display: flex; align-items: center; gap: 10px; line-height: 1.25; padding: 0; border: 0; background: transparent; }
.header-language .language-chevron, .language-picker .language-chevron { display: block; flex: 0 0 18px; width: 18px; height: 18px; fill: none; stroke: currentColor; stroke-width: 1.5; stroke-linecap: round; stroke-linejoin: round; }
.language-options { left: 0; right: auto; min-width: max-content; top: calc(100% + 4px); padding: 0; border: 0; background: transparent; box-shadow: none; }
.language-options a { min-height: 44px; padding: 10px 0; line-height: 1.4; background: transparent; text-shadow: 0 1px 12px rgba(0,0,0,.7); }
.language-options a:hover, .language-options a[aria-current] { background: transparent; }
.language-options a:hover, .language-picker a:hover { opacity: .75; }
.language-options a[aria-current="page"], .language-picker a[aria-current="page"] { display: none; }
.language-picker { width: fit-content; }
.language-picker div { position: static; padding: 4px 0 0 26px; border: 0; background: transparent; box-shadow: none; }
.language-picker a { min-height: 44px; padding: 10px 0; color: var(--white); line-height: 1.4; }
@media (max-width: 900px) {
 .header-language { display: none; }
 .definition { grid-template-columns: 1fr; min-height: auto; padding: 48px var(--gutter) 88px; }
 .definition-context { display: none; }
 .definition-copy { width: min(680px,100%); padding-top: 25px; justify-self: start; }
 .scope-heading { grid-template-columns: 1fr; gap: 22px; }
 .scope-heading > .eyebrow { grid-column: auto; }
 .scope-grid { gap: 24px; }
 .experience-note { width: 28%; }
 .philosophy-visual { min-height: 420px; height: 62vw; max-height: 600px; }
 .philosophy-visual img { position: absolute; inset: 0; }
 .philosophy-copy { min-height: auto; }
 .footer-main { grid-template-columns: 1.3fr 1fr 1fr; }
 .footer-brand { grid-column: 1 / -1; }
 .valuation .section-media { object-position: 50% 62%; }
}
@media (max-width: 600px) {
 .site-header { grid-template-columns: 44px minmax(100px,1fr) auto; gap: 10px; padding: 0 16px; height: 70px; }
 .wordmark { width: min(124px,100%); justify-self: center; }
 .menu-trigger { min-width: 44px; }
 .header-actions { min-width: 0; }
 .contact-button { display: inline-flex; font-size: .875rem; padding: 0 12px; min-height: 44px; }
 .hero { min-height: max(620px, 100svh); }
 .hero h1 { font-size: clamp(2.3rem,10vw,3.5rem); white-space: normal; max-width: 100%; line-height: 1.04; overflow-wrap: normal; hyphens: auto; }
 .hero-title-wrap { bottom: 196px; right: 20px; }
 .hero-promise { left: 20px; right: auto; bottom: 90px; width: min(300px,calc(100% - 40px)); font-size: 1rem; }
 .eyebrow { font-size: .75rem; }
 .discover { left: 20px; bottom: 26px; font-size: .875rem; flex-direction: row; align-items: center; gap: 14px; }
 .definition { padding: 32px 20px 78px; }
 .definition-copy { padding-top: 45px; }
 .definition-copy > p, .value-grid p, .experience-note p, .excellence-lead { font-size: 1rem; }
 .values { min-height: 930px; }
 .values-inner { padding: 60px 0 20px; }
 .value-grid { padding-top: 200px; }
 .value-grid article { min-height: 0; padding: 18px 20px; }
 .value-grid h3 { margin: 8px 0 8px; padding-right: 24px; }
 .value-grid p { max-width: none; }
 .value-mark { top: 20px; right: 18px; }
 .philosophy-visual { min-height: 340px; height: 90vw; max-height: 440px; }
 .philosophy-copy { padding: 65px 20px; }
 .scope { padding: 72px 20px; }
 .scope-grid { grid-template-columns: 1fr; margin-top: 38px; gap: 28px; }
 .scope-grid h3 { margin-top: 16px; }
 .scope-close { margin-top: 34px; }
 .experience { padding: 72px 20px; }
 .experience-stage { margin-top: 36px; }
 .experience-visual { height: clamp(340px,105vw,440px); }
 .experience-ring { display: none; }
 .experience-note { width: 100%; min-height: 0; grid-template-columns: 26px minmax(0,1fr); gap: 4px 12px; padding: 20px; }
 .note-outline { display: block; position: absolute; inset: -1px; width: calc(100% + 2px); height: calc(100% + 2px); overflow: visible; pointer-events: none; opacity: 0; }
 .note-outline rect { fill: none; stroke: #747674; stroke-width: 1.5px; stroke-linecap: round; vector-effect: non-scaling-stroke; stroke-dasharray: 1; stroke-dashoffset: 1; }
 .experience-note p { grid-column: 2; margin-top: 6px; }
 .experience-note h3 { font-size: 1.125rem; }
 .experience-statement { margin-top: 32px; }
 .excellence { display: flex; flex-direction: column; align-items: stretch; min-height: 0; padding: 62px 20px; }
 .excellence-veil { background: linear-gradient(180deg,rgba(0,0,0,.84),rgba(0,0,0,.75)); }
 .excellence-copy { order: 0; width: 100%; padding: 0; margin: 0; }
 .excellence-lead { margin-bottom: 25px; }
 .app-notifications { position: relative; order: 1; left: auto; right: auto; top: auto; width: 100%; gap: 28px; margin-top: 42px; transform: none; }
 .app-notification { padding: 18px 16px; border-radius: 20px; }
 .app-notification strong, .app-notification p { font-size: 1rem; }
 .app-notifications::before { top: 40px; bottom: 40px; }
 .why { padding: 84px 20px; }
 .founder-quote p { font-size: 1rem; }
 .faqs { padding: 80px 20px; }
 .accordion summary { font-size: 1rem; }
 .answer { margin: 0 17px; padding: 18px 0 22px; font-size: 1rem; }
 .valuation { min-height: 740px; }
 .valuation .section-media { object-position: 50% 50%; }
 .valuation-copy { width: 100%; padding: 240px 20px 52px; margin: 0; }
 .primary-button { font-size: .9375rem; padding: 14px 18px; min-height: 52px; gap: 20px; }
 .valuation-copy .primary-button { justify-content: space-between; width: 100%; }
 .footer-connect-inner { gap: 48px; }
 .footer-main { grid-template-columns: 1fr 1fr; }
 .footer-column:last-child { grid-column: 1 / -1; }
 .enquiry-dialog { padding: 38px 22px 26px; width: calc(100% - 20px); max-height: calc(100dvh - 20px); }
 .enquiry-actions a { font-size: .9375rem; }
}
/* One measured perimeter at a time: 2.5 seconds per card, then a quiet pause. */
@media (max-width: 600px) and (prefers-reduced-motion: no-preference) {
 .note-outline { animation: note-outline-visibility 10s linear infinite both; animation-play-state: paused; }
 .note-outline rect { animation: note-outline-trace 10s linear infinite both; animation-play-state: paused; }
 .note-calm .note-outline, .note-calm .note-outline rect { animation-delay: 3s; }
 .note-freedom .note-outline, .note-freedom .note-outline rect { animation-delay: 6s; }
 .notes-animating .note-outline, .notes-animating .note-outline rect { animation-play-state: running; }
}
@keyframes note-outline-visibility {
 0% { opacity: 0; }
 3%, 25% { opacity: 1; }
 29%, 100% { opacity: 0; }
}
@keyframes note-outline-trace {
 0% { stroke-dashoffset: 1; animation-timing-function: cubic-bezier(.4,0,.2,1); }
 25%, 100% { stroke-dashoffset: 0; }
}
@media (max-width: 370px) { .site-header { gap: 6px; padding: 0 12px; } .wordmark { width: 105px; } .contact-button { padding: 0 9px; } }
@media (prefers-reduced-motion: reduce) { .experience-stage .ring-progress { stroke-dashoffset: 0 !important; } }

/* Keep long menus and translated content usable on small or shallow viewports. */
.menu-panel { overflow-y: auto; overscroll-behavior: contain; }
.menu-panel > a { flex-shrink: 0; }
.enquiry-dialog { overflow-y: auto; }
.scope-grid article, .scope-heading > *, .footer-column { min-width: 0; }
.footer-column a { overflow-wrap: anywhere; }
@media (max-height: 720px) {
 .menu-panel { justify-content: flex-start; padding-top: 86px; }
}
@media (min-width: 601px) and (max-width: 900px) {
 .excellence { flex-direction: column; align-items: stretch; min-height: 0; padding: 70px var(--gutter); }
 .excellence-veil { background: linear-gradient(180deg,rgba(0,0,0,.84),rgba(0,0,0,.75)); }
 .excellence-copy { width: 100%; margin: 0; padding: 0; }
 .app-notifications { position: relative; left: auto; top: auto; width: min(520px,100%); margin-top: 44px; gap: 28px; transform: none; }
}


/* Stationary aftercare cards with a reversible, scroll-linked connecting trace. */
.notification-timing { display: flex; flex-direction: column; align-items: flex-end; gap: 4px; flex: 0 0 auto; max-width: 50%; text-align: right; }
.notification-moment { color: #aaa9a5; font-size: .75rem; line-height: 1.3; }
.notification-meta { gap: 12px; }
.notification-meta > strong { min-width: 0; }
.app-access { display: inline-flex; margin-top: 24px; min-height: 44px; align-items: center; }
.app-notifications::before, .app-notifications::after { content: ""; display: block; position: absolute; z-index: 0; top: var(--care-start,45px); bottom: var(--care-end,45px); left: 50%; width: 1px; pointer-events: none; }
.app-notifications::before { background: repeating-linear-gradient(to bottom,rgba(255,255,255,.12) 0 7px,transparent 7px 15px); }
.app-notifications::after { background: repeating-linear-gradient(to bottom,rgba(200,202,199,.72) 0 7px,transparent 7px 15px); clip-path: inset(0 0 var(--care-hidden,0%) 0); }
@media (prefers-reduced-motion: reduce) { .app-notifications::after { clip-path: none; } }

/* Underlined actions: a left-to-right red trace, then a quiet increase in weight. */
.text-link { position: relative; }
.text-link::after {
 content: "";
 position: absolute;
 left: 0;
 right: 0;
 bottom: -1px;
 height: 1px;
 background: var(--ferrari-red);
 transform: scaleX(0);
 transform-origin: left center;
 pointer-events: none;
 transition: transform 2400ms linear, height 200ms ease;
}
/* One link owns the lettering and underline, including the space between them.
   Draw the line inside its hit area and inherit the same animated currentColor. */
.text-link.app-access {
 color: var(--ferrari-red);
 border-bottom: 0;
 padding-bottom: 12px;
 background-image: linear-gradient(currentColor, currentColor);
 background-repeat: no-repeat;
 background-position: left bottom 3px;
 background-size: 100% 1px;
 -webkit-text-stroke: 0 currentColor;
 transition: color 400ms ease, background-size 400ms ease, -webkit-text-stroke-width 400ms ease;
}
.text-link.app-access::after { content: none; }
.text-link.app-access:focus-visible { color: #df2400; background-size: 100% 2px; -webkit-text-stroke-width: .2px; }
.text-link:focus-visible::after {
 transform: scaleX(1);
 height: 2px;
 transition: transform 2400ms linear, height 200ms ease 2400ms;
}
.primary-button:focus-visible, .contact-button:focus-visible { background: transparent; color: var(--ferrari-red); }
.secondary-button:focus-visible, .footer-outline-button:focus-visible { color: var(--ferrari-red); }
@media (hover: hover) and (pointer: fine) {
 .text-link:hover::after {
  transform: scaleX(1);
  height: 2px;
  transition: transform 2400ms linear, height 200ms ease 2400ms;
 }
 .primary-button:hover, .contact-button:hover, .secondary-button:hover { color: var(--ferrari-red); }
 .footer-outline-button:hover { color: var(--ferrari-red-on-light); }
 .text-link.app-access:hover { color: #df2400; background-size: 100% 2px; -webkit-text-stroke-width: .2px; }
}
@media (prefers-reduced-motion: reduce) {
 .text-link::after { transition: none !important; }
}

/* Desktop: the photograph supports the criteria, with a restrained central focus. */
@media (min-width: 901px) {
 .values { min-height: 0; background: #000; }
 .values .section-media { filter: brightness(.68) saturate(.78); }
 .values .section-veil {
  background: radial-gradient(circle at 52% 40%, rgba(0,0,0,.3) 0%, rgba(0,0,0,.48) 14%, rgba(0,0,0,.91) 38%, #000 64%);
 }
 .values-inner { min-height: 0; padding: clamp(72px,6vw,96px) 0 clamp(80px,7vw,112px); }
 .value-grid { margin-top: clamp(48px,4.5vw,72px); padding-top: 0; gap: 22px 24px; }
 .value-grid article { min-height: 164px; background: rgba(20,20,23,.66); }
 .value-grid h3 { margin: 0 0 14px; padding-right: 34px; }
}

/* Blend the closing photograph into the page on all four edges. */
.valuation { background: var(--black); }
.valuation-veil::after {
 content: "";
 position: absolute;
 inset: 0;
 pointer-events: none;
 background:
  linear-gradient(180deg,
   #050505 0%, rgba(5,5,5,.9) 3%, rgba(5,5,5,.55) 9%, rgba(5,5,5,.16) 17%, rgba(5,5,5,0) 25%,
   rgba(5,5,5,0) 73%, rgba(5,5,5,.16) 82%, rgba(5,5,5,.55) 91%, rgba(5,5,5,.9) 97%, #050505 100%),
  linear-gradient(90deg,
   #050505 0%, rgba(5,5,5,.65) 3%, rgba(5,5,5,.2) 8%, rgba(5,5,5,0) 16%,
   rgba(5,5,5,0) 82%, rgba(5,5,5,.2) 91%, rgba(5,5,5,.65) 97%, #050505 100%);
}
@media (max-width: 600px) {
 .valuation-veil::after {
  background:
   linear-gradient(180deg,
    #050505 0%, rgba(5,5,5,.8) 3%, rgba(5,5,5,.35) 9%, rgba(5,5,5,0) 20%,
    rgba(5,5,5,0) 76%, rgba(5,5,5,.35) 87%, rgba(5,5,5,.8) 96%, #050505 100%),
   linear-gradient(90deg,
    #050505 0%, rgba(5,5,5,.5) 3%, rgba(5,5,5,0) 12%,
    rgba(5,5,5,0) 88%, rgba(5,5,5,.5) 97%, #050505 100%);
 }
}

/* Nuestro sistema: a concise, image-led edition of the approved First Detail source. */
.system-page { --frame:0px; }
.system-page .menu-panel { background:rgba(5,5,5,.94); backdrop-filter:blur(24px); }
.system-page .visual-hero { min-height:780px; height:100svh; max-height:1080px; background:var(--black); }
.system-page .hero-media { object-position:50% 28%; transform:none; animation:none; }
.system-page .hero-shade { background:linear-gradient(180deg,rgba(5,5,5,.48),transparent 22%,transparent 42%,rgba(5,5,5,.25) 58%,#050505 100%); }
.visual-hero-copy { position:absolute; z-index:2; inset:auto var(--gutter) 100px; display:grid; grid-template-columns:1.55fr 1fr; align-items:end; gap:6vw; }
.system-page .hero h1 { font-weight:200; letter-spacing:.105em; font-size:clamp(2.2rem,4.5vw,4.8rem); line-height:1.2; hyphens:none; white-space:normal; }
.visual-promise { margin:19px 0 0; font-size:clamp(1.4rem,2.25vw,2.2rem); line-height:1.25; font-weight:300; letter-spacing:-.025em; }
.visual-support { margin:0 0 4px; max-width:370px; line-height:1.65; color:#e0e0da; font-size:1rem; }
.system-page .discover { left:var(--gutter); bottom:24px; transform:none; flex-direction:row; gap:16px; font-size:.85rem; }
.system-page .discover svg { width:20px; height:20px; }
.system-intro { padding:36px var(--gutter) 72px; display:grid; grid-template-columns:1fr 1fr; gap:30px 8vw; align-items:center; max-width:1560px; margin:auto; }
.system-intro .breadcrumb { grid-column:1/-1; margin-bottom:22px; }
.system-intro h2,.system-story h2,.system-setting h2,.compact-services h2 { margin:0; font-size:clamp(1.8rem,3.1vw,3.1rem); font-weight:300; line-height:1.14; letter-spacing:-.04em; }
.system-intro > p { margin:0; color:var(--readable); line-height:1.75; max-width:56ch; }
.system-story { display:grid; grid-template-columns:.85fr 1.15fr; align-items:center; gap:2vw; padding:35px var(--gutter); max-width:1680px; margin:auto; }
.story-copy { padding:30px 0; max-width:560px; }
.story-copy > p:not(.eyebrow) { color:var(--readable); font-size:1rem; line-height:1.75; margin:25px 0 0; max-width:49ch; }
.system-figure { position:relative; margin:0; min-width:0; }
.system-figure img { display:block; width:100%; height:auto; aspect-ratio:1.25; object-fit:cover; -webkit-mask-image:linear-gradient(180deg,transparent,#000 8%,#000 85%,transparent); mask-image:linear-gradient(180deg,transparent,#000 8%,#000 85%,transparent); }
.system-figure::after { content:''; position:absolute; inset:0; background:linear-gradient(90deg,#050505,transparent 9%,transparent 91%,#050505); pointer-events:none; }
.resource-list { margin:34px 0 0; }
.resource-list > div { margin-top:25px; }
.resource-list dt { font-size:1.12rem; font-weight:400; margin-bottom:10px; }
.resource-list dd { margin:0; max-width:42ch; line-height:1.7; color:var(--readable); }
.story-copy > .quiet-note { font-size:.875rem!important; color:#aaa9a5!important; max-width:46ch!important; padding-top:20px; border-top:1px solid var(--line); }
.care-story { grid-template-columns:1.15fr .85fr; }
.care-story .story-copy { padding-left:3vw; }
.care-steps { display:grid; grid-template-columns:repeat(3,minmax(0,1fr)); gap:18px; margin-top:34px; padding-top:22px; border-top:1px solid var(--line); }
.care-steps span { color:#999994; font-size:.75rem; letter-spacing:.1em; }
.care-steps h3 { margin:9px 0; font-size:1rem; font-weight:400; }
.care-steps p { color:#bdbdb7; font-size:.83rem; line-height:1.6; margin:0; }
.system-setting { display:grid; grid-template-columns:1.05fr .95fr; align-items:center; gap:30px 8vw; padding:85px var(--gutter) 60px; max-width:1520px; margin:auto; }
.setting-size { margin:32px 0 20px; font-size:clamp(2.5rem,4.1vw,4rem); font-weight:200; letter-spacing:-.045em; line-height:1; }
.setting-size span { display:block; margin-top:14px; color:#aaa9a5; font-size:.85rem; font-weight:400; letter-spacing:0; line-height:1.5; }
.setting-intro { color:var(--readable); line-height:1.7; max-width:55ch; }
.setting-grid { display:grid; grid-template-columns:1fr 1fr; gap:24px; margin:30px 0; }
.setting-grid h3 { margin:0 0 6px; font-size:1rem; font-weight:400; }
.setting-grid p { margin:0; font-size:.875rem; line-height:1.6; color:#bdbdb7; max-width:26ch; }
.secondary-figure { max-width:540px; margin:auto; }
.secondary-figure img { aspect-ratio:1.16; opacity:.72; }
.setting-details { max-width:490px; margin:25px auto 0; }
.setting-details p { font-size:.9375rem; line-height:1.7; color:var(--readable); margin:18px 0; }
.compact-services { display:grid; grid-template-columns:1fr 1fr; gap:8vw; padding:64px var(--gutter); border-top:1px solid var(--line); border-bottom:1px solid var(--line); }
.compact-services h2 { font-size:clamp(1.65rem,2.25vw,2.4rem); }
.compact-services p:not(.eyebrow) { margin:20px 0 0; color:var(--readable); max-width:49ch; line-height:1.7; }
.service-rows article { border-bottom:1px solid var(--line); padding:16px 0; display:flex; flex-direction:column; align-items:flex-start; }
.service-rows article:first-child { padding-top:0; }
.service-rows article:last-child { border:0; padding-bottom:0; }
.service-rows .text-link { line-height:1.6; font-size:1.05rem; }
.service-more { display:inline-flex; align-items:center; gap:10px; min-height:40px; color:#bfbfba; text-underline-offset:5px; line-height:1.6; font-size:.8rem; }
.service-more:hover,.service-more:focus-visible { color:var(--ferrari-red); }
.system-page .compact-faq { padding:75px var(--gutter); display:grid; grid-template-columns:.7fr 1.3fr; gap:6vw; align-items:start; }
.compact-faq .faq-heading { text-align:left; }
.compact-faq .faq-heading h2 { font-weight:300; line-height:1.2; font-size:clamp(1.8rem,2.9vw,2.7rem); }
.compact-faq .accordion { margin:0; width:100%; max-width:none; }
.compact-faq .accordion summary { line-height:1.5; padding-top:23px; padding-bottom:23px; }
.compact-faq .answer { line-height:1.75; }
.system-contact .primary-button { padding-top:16px; padding-bottom:16px; line-height:1.5; }
.system-contact .footer-connect-inner { align-items:center; gap:7vw; }
.system-contact .first-conversation > p { font-size:1rem; }
.system-page .language-picker summary svg { width:18px; height:18px; }
.system-page .primary-button,.system-page .text-link { max-width:100%; }
.no-script-contact { padding:30px var(--gutter); display:flex; gap:24px; }
@media(max-width:1100px) {
 .system-page .visual-hero { min-height:780px; max-height:1000px; }
 .visual-hero-copy { grid-template-columns:1.2fr .8fr; gap:4vw; }
 .system-page .hero h1 { font-size:clamp(2rem,4.5vw,3.6rem); }
 .system-story { gap:1vw; }
 .system-story h2 { font-size:2rem; }
 .care-steps { gap:12px; }
 .system-setting { gap:30px 5vw; }
}
@media(max-width:900px) {
 .visual-hero-copy { grid-template-columns:1fr; gap:24px; }
 .visual-support { max-width:46ch; }
 .system-page .hero h1 { font-size:3rem; }
 .system-intro { padding-bottom:35px; gap:25px 5vw; }
 .system-story { grid-template-columns:1fr; gap:0; padding-top:28px; padding-bottom:20px; }
 .story-copy { max-width:none; padding:20px 0; }
 .story-copy > p:not(.eyebrow),.resource-list dd { max-width:66ch; }
 .resource-list { display:grid; grid-template-columns:1fr 1fr; gap:25px; margin-top:10px; }
 .story-copy > .quiet-note { max-width:none!important; }
 .system-figure { max-width:780px; width:100%; margin:auto; }
 .system-figure img { aspect-ratio:1.45; }
 .care-story .story-copy { padding-left:0; grid-row:1; }
 .system-setting { padding-top:45px; }
 .system-setting h2 { font-size:2rem; }
 .secondary-figure img { aspect-ratio:1.16; }
 .compact-services { gap:5vw; }
 .system-page .compact-faq { grid-template-columns:1fr; gap:30px; padding-top:60px; padding-bottom:60px; }
 .compact-faq .faq-heading { display:flex; justify-content:space-between; gap:35px; align-items:center; }
 .compact-faq .faq-heading > p { max-width:32ch; margin:0; }
}
@media(max-width:600px) {
 .system-page .visual-hero { min-height:0; height:auto; max-height:none; padding:calc(66.67vw + 78px) 20px 100px; }
 .system-page .hero-media { top:64px; height:auto; aspect-ratio:1.5; object-position:50% 50%; }
 .system-page .hero-shade { top:64px; height:68vw; background:linear-gradient(180deg,transparent 65%,#050505 100%); }
 .visual-hero-copy { position:relative; inset:auto; gap:22px; }
 .system-page .hero h1 { font-size:clamp(1.7rem,6.3vw,2.4rem); letter-spacing:.08em; line-height:1.3; }
 .visual-promise { font-size:1.45rem; margin-top:15px; }
 .visual-support { font-size:.9375rem; line-height:1.65; max-width:40ch; }
 .system-page .discover { left:20px; bottom:28px; font-size:.83rem; min-height:44px; }
 .system-intro { display:block; padding:10px 20px 30px; }
 .system-intro .breadcrumb { margin-bottom:36px; }
 .system-intro h2 { font-size:1.8rem; }
 .system-intro > p { margin-top:24px; }
 .system-story { padding:25px 0 15px; }
 .story-copy { padding:10px 20px 15px; }
 .system-story h2 { font-size:clamp(1.65rem,7vw,2rem); }
 .resource-list { display:block; margin-top:28px; }
 .resource-list > div { margin-top:23px; }
 .resource-list dd { font-size:.9375rem; }
 .system-figure img { aspect-ratio:1.25; }
 .care-story .story-copy { padding:10px 20px 15px; }
 .story-copy > p:not(.eyebrow) { font-size:.9375rem; }
 .care-steps { gap:16px; margin-top:26px; }
 .care-steps h3 { font-size:.9375rem; }
 .care-steps p { font-size:.8rem; }
 .system-setting { display:block; padding:40px 20px; }
 .system-setting h2 { font-size:1.9rem; }
 .setting-size { font-size:3.5rem; }
 .setting-grid { gap:22px 20px; }
 .setting-visual { margin-top:40px; }
 .secondary-figure { max-width:370px; }
 .secondary-figure img { aspect-ratio:1.16; }
 .setting-details { margin-top:15px; }
 .compact-services { grid-template-columns:1fr; padding:40px 20px; gap:28px; }
 .compact-services h2 { font-size:1.75rem; }
 .service-rows .text-link { font-size:1rem; }
 .system-page .compact-faq { display:block; padding:45px 20px; }
 .compact-faq .faq-heading { display:block; margin-bottom:28px; }
 .compact-faq .faq-heading > p { margin-top:18px; }
 .compact-faq .accordion summary { font-size:1rem; padding-top:20px; padding-bottom:20px; }
 .system-contact .primary-button { width:100%; justify-content:space-between; }
 .system-page .footer-connect { padding:50px 20px; }
 .system-page .footer-connect-inner { gap:35px; }
 .system-page .footer-main { column-gap:22px; }
 .system-page .footer-column a { line-height:1.6; }
}
@media(prefers-reduced-motion:reduce) {
 .system-page *, .system-page *::before, .system-page *::after { scroll-behavior:auto!important; animation:none!important; transition:none!important; }
}
/* Keep the whole structure legible in portrait layouts and fade the photograph itself. */
@media(max-width:900px) {
 .system-page .hero-media { -webkit-mask-image:linear-gradient(#000 76%,transparent 100%); mask-image:linear-gradient(#000 76%,transparent 100%); }
}
@media(min-width:601px) and (max-width:900px) {
 .system-page .visual-hero { min-height:0; height:auto; max-height:none; padding:calc(66.67vw + 80px) var(--gutter) 104px; }
 .system-page .hero-media { top:64px; height:auto; aspect-ratio:1.5; object-position:50% 50%; }
 .system-page .hero-shade { top:64px; height:68vw; background:linear-gradient(180deg,transparent 65%,#050505 100%); }
 .visual-hero-copy { position:relative; inset:auto; }
}

/* Each service row is one native destination, including its secondary label. */
.service-destination { display:flex; flex-direction:column; align-items:flex-start; width:100%; text-decoration:none; }
.service-destination .text-link { display:inline-flex; align-items:center; justify-content:space-between; gap:18px; }
.service-destination .service-more { text-decoration:underline; }
.service-destination:focus-visible .text-link::after { transform:scaleX(1); height:2px; transition:transform 2400ms linear,height 200ms ease 2400ms; }
.service-destination:focus-visible .text-link,.service-destination:focus-visible .service-more { color:var(--ferrari-red); }
@media (hover:hover) and (pointer:fine) {
 .service-destination:hover .text-link::after { transform:scaleX(1); height:2px; transition:transform 2400ms linear,height 200ms ease 2400ms; }
 .service-destination:hover .text-link,.service-destination:hover .service-more { color:var(--ferrari-red); }
}